Stocking distributor of Electronic Components
Email: [email protected]
| Manufacturer Part Number: | SIT1602BIF11-33N-20.000000E |
|---|---|
| Manufacturer: | SiTIME |
| Product Category: | Oscillators |
| Available Quantity: | 9010 Pieces |
| Unit Price: | Quote by Email |
| Description: | Oscillator |
| Lead Free Status / RoHS Status: | Lead free / RoHS Compliant |
| Moisture Sensitivity Level (MSL): | 1 (Unlimited) |
| Production Status (Lifecycle): | In Production |
| Delivery Time: | 1-2 Days |
| Date Code (D/C): | New |
| Datasheet Download: | SIT1602BIF11-33N-20.000000E Datasheet |
| Internal Part Number | 898-SIT1602BIF11-33N-20.000000E | |
| Manufacturer Lead time | 6-8 weeks | |
| Condition | New & Unused, Original Sealed | |
| PCN Packaging | TR Pkg Update 27/Jul/2016 | |
| Category | Crystals and Oscillators | |
| Family | Oscillators | |
| Manufacturer | SiTIME | |
| Series | * | |
| Packaging | * | |
| Part Status | New Product | |
| Type | * | |
| Frequency | * | |
| Function | * | |
| Output | * | |
| Voltage - Supply | * | |
| Frequency Stability | * | |
| Operating Temperature | * | |
| Current - Supply (Max) | * | |
| Ratings | * | |
| Mounting Type | * | |
| Size / Dimension | * | |
| Height | * | |
| Package / Case | * | |
| Current - Supply (Disable) (Max) | * | |
| Standard Package | 1,000 | |
| Weight | 0.001 KG | |
| Application | Email for details | |
| Replacement Part | SIT1602BIF11-33N-20.000000E | |
| Country of Origin | USA / JAPAN / Philippines / Malaysia | |
| MOQ | 1 Piece | |
| Picture / Image / Photo | Send via email | |
SIT1602BIF11-33N-20.000000E is in stock for immediate shipping now. We are the distributor of SiTIME all series components. The condition of SIT1602BIF11-33N-20.000000E is new and unused, you can buy SIT1602BIF11-33N-20.000000E SiTIME with us at a very low price and quick delivery.
Please kindly send us an email if you have any demands for SIT1602BIF11-33N-20.000000E.
| BFC238055752 | 7500pF Film Capacitor 200V 400V Polypropylene (PP), Metallized Radial 0.283" L x 0.138" W (7.20mm x 3.50mm) | BFC238055752.pdf | |
| IELB1-1-52-10.0-2-01-V | CIR BRKR MAG-HYDR LEVER 10A | IELB1-1-52-10.0-2-01-V.pdf | |
| PCN10HC-50P-2.54DSA(72) | CONN DIN HEADER 50POS | PCN10HC-50P-2.54DSA(72).pdf | |
| ELL-6SH3R3M | 3.3µH Shielded Wirewound Inductor 2.2A 34 mOhm Nonstandard | ELL-6SH3R3M.pdf | |
| CS4398-CZZR | DAC, Audio 24 bit 216k DSD, PCM 28-TSSOP | CS4398-CZZR.pdf | |
| THS4151IDGN | Differential Amplifier 1 Circuit Differential 8-MSOP-PowerPad | THS4151IDGN.pdf | |
| VI-B7N-MW | CONVERTER MOD DC/DC 18.5V 100W | VI-B7N-MW.pdf | |
| GPM200A | AC/DC CNVRTR 5V +/-12V 12V 200W | GPM200A.pdf | |
| CA3100E22-20PF80 | 9 Position Circular Connector Receptacle, Male Pins Crimp Silver | CA3100E22-20PF80.pdf | |
| CN0966A20A41S7-200 | 41 Position Circular Connector Plug, Female Sockets Crimp Gold | CN0966A20A41S7-200.pdf | |
| 2098252-3 | Pin Contact Nickel Crimp 1.5 ~ 2.5mm² | 2098252-3.pdf | |
| 0705750054 | 20 Positions Header, Shrouded Connector 0.100" (2.54mm) Through Hole, Right Angle Gold | 0705750054.pdf | |
| 9T06031A2802CAHFT | RES SMD 28K OHM 0.25% 1/10W 0603 | 9T06031A2802CAHFT.pdf |